C13H18Cl2N2OS — CID 107963586
(2,5-dichlorothiophen-3-yl)-(2,5-diethylpiperazin-1-yl)methanone (PubChem CID 107963586) has the molecular formula C13H18Cl2N2OS and a molecular weight of 321.27 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(2,5-diethylpiperazin-1-yl)methanone.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(2,5-diethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 107963586 |
| Molecular Formula | C13H18Cl2N2OS |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(2,5-diethylpiperazin-1-yl)methanone |
| SMILES | CCC1CN(C(=O)c2cc(Cl)sc2Cl)C(CC)CN1 |
| InChI | InChI=1S/C13H18Cl2N2OS/c1-3-8-7-17(9(4-2)6-16-8)13(18)10-5-11(14)19-12(10)15/h5,8-9,16H,3-4,6-7H2,1-2H3 |
| InChIKey | RPKSYSUMDIZLKC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |