C15H24N2OS — CID 64978414
(2,5-diethylpiperazin-1-yl)-(3-ethylthiophen-2-yl)methanone (PubChem CID 64978414) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is (2,5-diethylpiperazin-1-yl)-(3-ethylthiophen-2-yl)methanone.
| Compound Name | (2,5-diethylpiperazin-1-yl)-(3-ethylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 64978414 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (2,5-diethylpiperazin-1-yl)-(3-ethylthiophen-2-yl)methanone |
| SMILES | CCc1ccsc1C(=O)N1CC(CC)NCC1CC |
| InChI | InChI=1S/C15H24N2OS/c1-4-11-7-8-19-14(11)15(18)17-10-12(5-2)16-9-13(17)6-3/h7-8,12-13,16H,4-6,9-10H2,1-3H3 |
| InChIKey | AWLGVLHYMIEDSO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |