C16H23BrN2O — CID 64977891
2-(4-bromophenyl)-1-(2,5-diethylpiperazin-1-yl)ethanone (PubChem CID 64977891) has the molecular formula C16H23BrN2O and a molecular weight of 339.28 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(2,5-diethylpiperazin-1-yl)ethanone.
| Compound Name | 2-(4-bromophenyl)-1-(2,5-diethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 64977891 |
| Molecular Formula | C16H23BrN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-(4-bromophenyl)-1-(2,5-diethylpiperazin-1-yl)ethanone |
| SMILES | CCC1CN(C(=O)Cc2ccc(Br)cc2)C(CC)CN1 |
| InChI | InChI=1S/C16H23BrN2O/c1-3-14-11-19(15(4-2)10-18-14)16(20)9-12-5-7-13(17)8-6-12/h5-8,14-15,18H,3-4,9-11H2,1-2H3 |
| InChIKey | VDNAXLONNZAVBR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |