C14H22N2OS — CID 64978280
1-(2,5-diethylpiperazin-1-yl)-2-thiophen-3-ylethanone (PubChem CID 64978280) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 1-(2,5-diethylpiperazin-1-yl)-2-thiophen-3-ylethanone.
| Compound Name | 1-(2,5-diethylpiperazin-1-yl)-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 64978280 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-(2,5-diethylpiperazin-1-yl)-2-thiophen-3-ylethanone |
| SMILES | CCC1CN(C(=O)Cc2ccsc2)C(CC)CN1 |
| InChI | InChI=1S/C14H22N2OS/c1-3-12-9-16(13(4-2)8-15-12)14(17)7-11-5-6-18-10-11/h5-6,10,12-13,15H,3-4,7-9H2,1-2H3 |
| InChIKey | WRFZKKXPBJERCS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |