C12H15N3O4 — CID 107728749
1-(3,4-dihydroxybenzoyl)piperazine-2-carboxamide (PubChem CID 107728749) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1-(3,4-dihydroxybenzoyl)piperazine-2-carboxamide.
| Compound Name | 1-(3,4-dihydroxybenzoyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 107728749 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-(3,4-dihydroxybenzoyl)piperazine-2-carboxamide |
| SMILES | NC(=O)C1CNCCN1C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H15N3O4/c13-11(18)8-6-14-3-4-15(8)12(19)7-1-2-9(16)10(17)5-7/h1-2,5,8,14,16-17H,3-4,6H2,(H2,13,18) |
| InChIKey | PJKCNEAVYPNTIU-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|