C13H17BrN2O — CID 62036990
1-(3-bromophenyl)-2-(1,4-diazepan-1-yl)ethanone (PubChem CID 62036990) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(1,4-diazepan-1-yl)ethanone.
| Compound Name | 1-(3-bromophenyl)-2-(1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 62036990 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-(3-bromophenyl)-2-(1,4-diazepan-1-yl)ethanone |
| SMILES | O=C(CN1CCCNCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O/c14-12-4-1-3-11(9-12)13(17)10-16-7-2-5-15-6-8-16/h1,3-4,9,15H,2,5-8,10H2 |
| InChIKey | IPIDKFPAXIJEDT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |