C16H14BrNO — CID 55049854
1-(3-bromophenyl)-2-(1,3-dihydroisoindol-2-yl)ethanone (PubChem CID 55049854) has the molecular formula C16H14BrNO and a molecular weight of 316.20 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(1,3-dihydroisoindol-2-yl)ethanone.
| Compound Name | 1-(3-bromophenyl)-2-(1,3-dihydroisoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 55049854 |
| Molecular Formula | C16H14BrNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 1-(3-bromophenyl)-2-(1,3-dihydroisoindol-2-yl)ethanone |
| SMILES | O=C(CN1Cc2ccccc2C1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H14BrNO/c17-15-7-3-6-12(8-15)16(19)11-18-9-13-4-1-2-5-14(13)10-18/h1-8H,9-11H2 |
| InChIKey | VHWASYHDIPEZBJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |