C15H20BrNOS — CID 107456818
1-(3-bromophenyl)-2-(7,7-dimethyl-1,4-thiazepan-4-yl)ethanone (PubChem CID 107456818) has the molecular formula C15H20BrNOS and a molecular weight of 342.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(7,7-dimethyl-1,4-thiazepan-4-yl)ethanone.
| Compound Name | 1-(3-bromophenyl)-2-(7,7-dimethyl-1,4-thiazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 107456818 |
| Molecular Formula | C15H20BrNOS |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1-(3-bromophenyl)-2-(7,7-dimethyl-1,4-thiazepan-4-yl)ethanone |
| SMILES | CC1(C)CCN(CC(=O)c2cccc(Br)c2)CCS1 |
| InChI | InChI=1S/C15H20BrNOS/c1-15(2)6-7-17(8-9-19-15)11-14(18)12-4-3-5-13(16)10-12/h3-5,10H,6-9,11H2,1-2H3 |
| InChIKey | WPGIKIGBMHKJLH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |