C14H17Cl2NO — CID 43227244
2-(azepan-1-yl)-1-(2,5-dichlorophenyl)ethanone (PubChem CID 43227244) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is 2-(azepan-1-yl)-1-(2,5-dichlorophenyl)ethanone.
| Compound Name | 2-(azepan-1-yl)-1-(2,5-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 43227244 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-(azepan-1-yl)-1-(2,5-dichlorophenyl)ethanone |
| SMILES | O=C(CN1CCCCCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H17Cl2NO/c15-11-5-6-13(16)12(9-11)14(18)10-17-7-3-1-2-4-8-17/h5-6,9H,1-4,7-8,10H2 |
| InChIKey | ZBYXRTWHWKMVDP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |