C15H19Cl2NO — CID 43794680
1-(2,5-dichlorophenyl)-2-(2,6-dimethylpiperidin-1-yl)ethanone (PubChem CID 43794680) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(2,6-dimethylpiperidin-1-yl)ethanone.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(2,6-dimethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 43794680 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(2,6-dimethylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCC(C)N1CC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H19Cl2NO/c1-10-4-3-5-11(2)18(10)9-15(19)13-8-12(16)6-7-14(13)17/h6-8,10-11H,3-5,9H2,1-2H3 |
| InChIKey | BUSGRKNPHTVZJQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |