C14H16Cl2N2O2 — CID 43228705
1-[2-(2,4-dichlorophenyl)-2-oxoethyl]piperidine-3-carboxamide (PubChem CID 43228705) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-oxoethyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-oxoethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43228705 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-oxoethyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(CC(=O)c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H16Cl2N2O2/c15-10-3-4-11(12(16)6-10)13(19)8-18-5-1-2-9(7-18)14(17)20/h3-4,6,9H,1-2,5,7-8H2,(H2,17,20) |
| InChIKey | SOBMXGVFINYTII-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |