C13H16Cl2N2O — CID 6456279
1-[(3,4-dichlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 6456279) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 6456279 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H16Cl2N2O/c14-11-4-3-9(6-12(11)15)7-17-5-1-2-10(8-17)13(16)18/h3-4,6,10H,1-2,5,7-8H2,(H2,16,18) |
| InChIKey | AVDQZGGUVJXHCZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |