C16H22Cl2N2O — CID 99785633
(3S)-1-[4-(3,4-dichlorophenyl)butyl]piperidine-3-carboxamide (PubChem CID 99785633) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is (3S)-1-[4-(3,4-dichlorophenyl)butyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[4-(3,4-dichlorophenyl)butyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 99785633 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (3S)-1-[4-(3,4-dichlorophenyl)butyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN(CCCCc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H22Cl2N2O/c17-14-7-6-12(10-15(14)18)4-1-2-8-20-9-3-5-13(11-20)16(19)21/h6-7,10,13H,1-5,8-9,11H2,(H2,19,21)/t13-/m0/s1 |
| InChIKey | ICYMZLBZVILRFJ-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|