C16H23Cl2N3O3S — CID 131909787
1-[3-[(2,4-dichloro-3-methylphenyl)sulfonylamino]propyl]piperidine-3-carboxamide (PubChem CID 131909787) has the molecular formula C16H23Cl2N3O3S and a molecular weight of 408.35 g/mol. Its IUPAC name is 1-[3-[(2,4-dichloro-3-methylphenyl)sulfonylamino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[(2,4-dichloro-3-methylphenyl)sulfonylamino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 131909787 |
| Molecular Formula | C16H23Cl2N3O3S |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 1-[3-[(2,4-dichloro-3-methylphenyl)sulfonylamino]propyl]piperidine-3-carboxamide |
| SMILES | Cc1c(Cl)ccc(S(=O)(=O)NCCCN2CCCC(C(N)=O)C2)c1Cl |
| InChI | InChI=1S/C16H23Cl2N3O3S/c1-11-13(17)5-6-14(15(11)18)25(23,24)20-7-3-9-21-8-2-4-12(10-21)16(19)22/h5-6,12,20H,2-4,7-10H2,1H3,(H2,19,22) |
| InChIKey | IPJYGWJXLIQSQC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|