C18H27ClN4O5S — CID 56547862
1-[3-[[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 56547862) has the molecular formula C18H27ClN4O5S and a molecular weight of 446.96 g/mol. Its IUPAC name is 1-[3-[[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56547862 |
| Molecular Formula | C18H27ClN4O5S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-[3-[[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)NCCCN2CCCC(C(N)=O)C2)ccc1Cl |
| InChI | InChI=1S/C18H27ClN4O5S/c1-22(28-2)29(26,27)16-11-13(6-7-15(16)19)18(25)21-8-4-10-23-9-3-5-14(12-23)17(20)24/h6-7,11,14H,3-5,8-10,12H2,1-2H3,(H2,20,24)(H,21,25) |
| InChIKey | YTZZERBWRKYOAC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|