C22H26FN3O2 — CID 125172984
(3R)-1-[3-[[3-(4-fluorophenyl)benzoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 125172984) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is (3R)-1-[3-[[3-(4-fluorophenyl)benzoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[3-[[3-(4-fluorophenyl)benzoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125172984 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (3R)-1-[3-[[3-(4-fluorophenyl)benzoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(CCCNC(=O)c2cccc(-c3ccc(F)cc3)c2)C1 |
| InChI | InChI=1S/C22H26FN3O2/c23-20-9-7-16(8-10-20)17-4-1-5-18(14-17)22(28)25-11-3-13-26-12-2-6-19(15-26)21(24)27/h1,4-5,7-10,14,19H,2-3,6,11-13,15H2,(H2,24,27)(H,25,28)/t19-/m1/s1 |
| InChIKey | YXHCVZBVZKBVAX-LJQANCHMSA-N |
| XLogP | 2.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|