C22H27FN4O2S — CID 56547756
N-[3-(3-carbamoylpiperidin-1-yl)propyl]-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide (PubChem CID 56547756) has the molecular formula C22H27FN4O2S and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[3-(3-carbamoylpiperidin-1-yl)propyl]-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide.
| Compound Name | N-[3-(3-carbamoylpiperidin-1-yl)propyl]-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56547756 |
| Molecular Formula | C22H27FN4O2S |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | N-[3-(3-carbamoylpiperidin-1-yl)propyl]-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(CCCNC(=O)c2cccnc2SCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H27FN4O2S/c23-18-8-6-16(7-9-18)15-30-22-19(5-1-10-26-22)21(29)25-11-3-13-27-12-2-4-17(14-27)20(24)28/h1,5-10,17H,2-4,11-15H2,(H2,24,28)(H,25,29) |
| InChIKey | FEGRIZDKGYKCOU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|