C21H30N4O2S — CID 47041493
2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-[4-(3-methylpiperidin-1-yl)butyl]pyridine-3-carboxamide (PubChem CID 47041493) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-[4-(3-methylpiperidin-1-yl)butyl]pyridine-3-carboxamide.
| Compound Name | 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-[4-(3-methylpiperidin-1-yl)butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47041493 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-[4-(3-methylpiperidin-1-yl)butyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(CSc2ncccc2C(=O)NCCCCN2CCCC(C)C2)no1 |
| InChI | InChI=1S/C21H30N4O2S/c1-16-7-6-12-25(14-16)11-4-3-9-22-20(26)19-8-5-10-23-21(19)28-15-18-13-17(2)27-24-18/h5,8,10,13,16H,3-4,6-7,9,11-12,14-15H2,1-2H3,(H,22,26) |
| InChIKey | KUOCNCOUOVNCKA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|