C20H28N4O2S — CID 51255908
2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]pyridine-3-carboxamide (PubChem CID 51255908) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]pyridine-3-carboxamide.
| Compound Name | 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51255908 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(CSc2ncccc2C(=O)NCCCN2CCCCC2C)no1 |
| InChI | InChI=1S/C20H28N4O2S/c1-15-7-3-4-11-24(15)12-6-10-21-19(25)18-8-5-9-22-20(18)27-14-17-13-16(2)26-23-17/h5,8-9,13,15H,3-4,6-7,10-12,14H2,1-2H3,(H,21,25) |
| InChIKey | XBHMEXYUBODNMU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|