C17H26N4O2 — CID 28733147
(3S)-1-[2-[[2-(dimethylamino)benzoyl]amino]ethyl]piperidine-3-carboxamide (PubChem CID 28733147) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (3S)-1-[2-[[2-(dimethylamino)benzoyl]amino]ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[2-[[2-(dimethylamino)benzoyl]amino]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28733147 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (3S)-1-[2-[[2-(dimethylamino)benzoyl]amino]ethyl]piperidine-3-carboxamide |
| SMILES | CN(C)c1ccccc1C(=O)NCCN1CCC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C17H26N4O2/c1-20(2)15-8-4-3-7-14(15)17(23)19-9-11-21-10-5-6-13(12-21)16(18)22/h3-4,7-8,13H,5-6,9-12H2,1-2H3,(H2,18,22)(H,19,23)/t13-/m0/s1 |
| InChIKey | LELPRFVTIVXSHZ-ZDUSSCGKSA-N |
| XLogP | 0.68 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |