C20H25N5O2 — CID 77084193
N-[2-(3-carbamoylpiperidin-1-yl)ethyl]-2-methyl-4-phenylpyrimidine-5-carboxamide (PubChem CID 77084193) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-[2-(3-carbamoylpiperidin-1-yl)ethyl]-2-methyl-4-phenylpyrimidine-5-carboxamide.
| Compound Name | N-[2-(3-carbamoylpiperidin-1-yl)ethyl]-2-methyl-4-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 77084193 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[2-(3-carbamoylpiperidin-1-yl)ethyl]-2-methyl-4-phenylpyrimidine-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NCCN2CCCC(C(N)=O)C2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H25N5O2/c1-14-23-12-17(18(24-14)15-6-3-2-4-7-15)20(27)22-9-11-25-10-5-8-16(13-25)19(21)26/h2-4,6-7,12,16H,5,8-11,13H2,1H3,(H2,21,26)(H,22,27) |
| InChIKey | SWELKKTTXYKINP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |