C21H28N4O2 — CID 77096074
N-[2-(3-carbamoylpiperidin-1-yl)ethyl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide (PubChem CID 77096074) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[2-(3-carbamoylpiperidin-1-yl)ethyl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide.
| Compound Name | N-[2-(3-carbamoylpiperidin-1-yl)ethyl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide |
|---|---|
| PubChem CID | 77096074 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-[2-(3-carbamoylpiperidin-1-yl)ethyl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide |
| SMILES | NC(=O)C1CCCN(CCNC(=O)c2ccc3c4c([nH]c3c2)CCCC4)C1 |
| InChI | InChI=1S/C21H28N4O2/c22-20(26)15-4-3-10-25(13-15)11-9-23-21(27)14-7-8-17-16-5-1-2-6-18(16)24-19(17)12-14/h7-8,12,15,24H,1-6,9-11,13H2,(H2,22,26)(H,23,27) |
| InChIKey | CWHJYBYQJUGHGH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|