C19H25N3O — CID 95194960
N-[[(3R)-1-methylpyrrolidin-3-yl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide (PubChem CID 95194960) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[[(3R)-1-methylpyrrolidin-3-yl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide.
| Compound Name | N-[[(3R)-1-methylpyrrolidin-3-yl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide |
|---|---|
| PubChem CID | 95194960 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[[(3R)-1-methylpyrrolidin-3-yl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide |
| SMILES | CN1CC[C@H](CNC(=O)c2ccc3c4c([nH]c3c2)CCCC4)C1 |
| InChI | InChI=1S/C19H25N3O/c1-22-9-8-13(12-22)11-20-19(23)14-6-7-16-15-4-2-3-5-17(15)21-18(16)10-14/h6-7,10,13,21H,2-5,8-9,11-12H2,1H3,(H,20,23)/t13-/m1/s1 |
| InChIKey | VMHMIXGHUPPOHX-CYBMUJFWSA-N |
| XLogP | 2.73 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|