C19H24N6O2 — CID 126436789
(3R)-1-[2-[[4-(6-aminopyrimidin-4-yl)benzoyl]amino]ethyl]piperidine-3-carboxamide (PubChem CID 126436789) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (3R)-1-[2-[[4-(6-aminopyrimidin-4-yl)benzoyl]amino]ethyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-[[4-(6-aminopyrimidin-4-yl)benzoyl]amino]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126436789 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (3R)-1-[2-[[4-(6-aminopyrimidin-4-yl)benzoyl]amino]ethyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(CCNC(=O)c2ccc(-c3cc(N)ncn3)cc2)C1 |
| InChI | InChI=1S/C19H24N6O2/c20-17-10-16(23-12-24-17)13-3-5-14(6-4-13)19(27)22-7-9-25-8-1-2-15(11-25)18(21)26/h3-6,10,12,15H,1-2,7-9,11H2,(H2,21,26)(H,22,27)(H2,20,23,24)/t15-/m1/s1 |
| InChIKey | SUCBKGHSNFOQGF-OAHLLOKOSA-N |
| XLogP | 0.65 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |