C18H29N5O2 — CID 95350170
(3R)-1-[3-[[2-(dimethylamino)phenyl]carbamoylamino]propyl]piperidine-3-carboxamide (PubChem CID 95350170) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (3R)-1-[3-[[2-(dimethylamino)phenyl]carbamoylamino]propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[3-[[2-(dimethylamino)phenyl]carbamoylamino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95350170 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (3R)-1-[3-[[2-(dimethylamino)phenyl]carbamoylamino]propyl]piperidine-3-carboxamide |
| SMILES | CN(C)c1ccccc1NC(=O)NCCCN1CCC[C@@H](C(N)=O)C1 |
| InChI | InChI=1S/C18H29N5O2/c1-22(2)16-9-4-3-8-15(16)21-18(25)20-10-6-12-23-11-5-7-14(13-23)17(19)24/h3-4,8-9,14H,5-7,10-13H2,1-2H3,(H2,19,24)(H2,20,21,25)/t14-/m1/s1 |
| InChIKey | YPTBDZKJIYZWAV-CQSZACIVSA-N |
| XLogP | 1.46 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|