C16H31N3O3 — CID 100856545
(3R)-1-[3-[[(2R)-2-(2-methylpropoxy)propanoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 100856545) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is (3R)-1-[3-[[(2R)-2-(2-methylpropoxy)propanoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[3-[[(2R)-2-(2-methylpropoxy)propanoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 100856545 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (3R)-1-[3-[[(2R)-2-(2-methylpropoxy)propanoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | CC(C)CO[C@H](C)C(=O)NCCCN1CCC[C@@H](C(N)=O)C1 |
| InChI | InChI=1S/C16H31N3O3/c1-12(2)11-22-13(3)16(21)18-7-5-9-19-8-4-6-14(10-19)15(17)20/h12-14H,4-11H2,1-3H3,(H2,17,20)(H,18,21)/t13-,14-/m1/s1 |
| InChIKey | DODXLEWPTBIEOH-ZIAGYGMSSA-N |
| XLogP | 0.75 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|