C17H24ClN5O3 — CID 97445320
(3S)-1-[3-[(4-carbamoyl-3-chlorophenyl)carbamoylamino]propyl]piperidine-3-carboxamide (PubChem CID 97445320) has the molecular formula C17H24ClN5O3 and a molecular weight of 381.86 g/mol. Its IUPAC name is (3S)-1-[3-[(4-carbamoyl-3-chlorophenyl)carbamoylamino]propyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[3-[(4-carbamoyl-3-chlorophenyl)carbamoylamino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97445320 |
| Molecular Formula | C17H24ClN5O3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (3S)-1-[3-[(4-carbamoyl-3-chlorophenyl)carbamoylamino]propyl]piperidine-3-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)NCCCN2CCC[C@H](C(N)=O)C2)cc1Cl |
| InChI | InChI=1S/C17H24ClN5O3/c18-14-9-12(4-5-13(14)16(20)25)22-17(26)21-6-2-8-23-7-1-3-11(10-23)15(19)24/h4-5,9,11H,1-3,6-8,10H2,(H2,19,24)(H2,20,25)(H2,21,22,26)/t11-/m0/s1 |
| InChIKey | NIRIJCSYTNFBTA-NSHDSACASA-N |
| XLogP | 1.15 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|