C15H22FN5O2 — CID 118767012
1-[3-[(5-fluoro-3-pyridinyl)carbamoylamino]propyl]piperidine-3-carboxamide (PubChem CID 118767012) has the molecular formula C15H22FN5O2 and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-[3-[(5-fluoro-3-pyridinyl)carbamoylamino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[(5-fluoro-3-pyridinyl)carbamoylamino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 118767012 |
| Molecular Formula | C15H22FN5O2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-[3-[(5-fluoro-3-pyridinyl)carbamoylamino]propyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(CCCNC(=O)Nc2cncc(F)c2)C1 |
| InChI | InChI=1S/C15H22FN5O2/c16-12-7-13(9-18-8-12)20-15(23)19-4-2-6-21-5-1-3-11(10-21)14(17)22/h7-9,11H,1-6,10H2,(H2,17,22)(H2,19,20,23) |
| InChIKey | MJCPOTMOWPDLMI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|