C14H20ClFN4O — CID 134697105
1-[3-[(5-chloro-3-fluoro-2-pyridinyl)amino]propyl]piperidine-3-carboxamide (PubChem CID 134697105) has the molecular formula C14H20ClFN4O and a molecular weight of 314.79 g/mol. Its IUPAC name is 1-[3-[(5-chloro-3-fluoro-2-pyridinyl)amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[(5-chloro-3-fluoro-2-pyridinyl)amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 134697105 |
| Molecular Formula | C14H20ClFN4O |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-[3-[(5-chloro-3-fluoro-2-pyridinyl)amino]propyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(CCCNc2ncc(Cl)cc2F)C1 |
| InChI | InChI=1S/C14H20ClFN4O/c15-11-7-12(16)14(19-8-11)18-4-2-6-20-5-1-3-10(9-20)13(17)21/h7-8,10H,1-6,9H2,(H2,17,21)(H,18,19) |
| InChIKey | HCSAJOFSDUMSSK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|