C16H28N6O — CID 72913557
1-[3-[(2-amino-6-ethyl-5-methylpyrimidin-4-yl)amino]propyl]piperidine-3-carboxamide (PubChem CID 72913557) has the molecular formula C16H28N6O and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-[3-[(2-amino-6-ethyl-5-methylpyrimidin-4-yl)amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[(2-amino-6-ethyl-5-methylpyrimidin-4-yl)amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72913557 |
| Molecular Formula | C16H28N6O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 1-[3-[(2-amino-6-ethyl-5-methylpyrimidin-4-yl)amino]propyl]piperidine-3-carboxamide |
| SMILES | CCc1nc(N)nc(NCCCN2CCCC(C(N)=O)C2)c1C |
| InChI | InChI=1S/C16H28N6O/c1-3-13-11(2)15(21-16(18)20-13)19-7-5-9-22-8-4-6-12(10-22)14(17)23/h12H,3-10H2,1-2H3,(H2,17,23)(H3,18,19,20,21) |
| InChIKey | TYXJTGFYAXQSHE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|