C16H29N5O — CID 72912546
[1-[3-[(2-amino-5-ethyl-6-methylpyrimidin-4-yl)amino]propyl]piperidin-3-yl]methanol (PubChem CID 72912546) has the molecular formula C16H29N5O and a molecular weight of 307.44 g/mol. Its IUPAC name is [1-[3-[(2-amino-5-ethyl-6-methylpyrimidin-4-yl)amino]propyl]piperidin-3-yl]methanol.
| Compound Name | [1-[3-[(2-amino-5-ethyl-6-methylpyrimidin-4-yl)amino]propyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 72912546 |
| Molecular Formula | C16H29N5O |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | [1-[3-[(2-amino-5-ethyl-6-methylpyrimidin-4-yl)amino]propyl]piperidin-3-yl]methanol |
| SMILES | CCc1c(C)nc(N)nc1NCCCN1CCCC(CO)C1 |
| InChI | InChI=1S/C16H29N5O/c1-3-14-12(2)19-16(17)20-15(14)18-7-5-9-21-8-4-6-13(10-21)11-22/h13,22H,3-11H2,1-2H3,(H3,17,18,19,20) |
| InChIKey | HUWLDUHYVBLKKU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|