C14H20F3N5O — CID 94819135
(3R)-1-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propyl]piperidine-3-carboxamide (PubChem CID 94819135) has the molecular formula C14H20F3N5O and a molecular weight of 331.34 g/mol. Its IUPAC name is (3R)-1-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94819135 |
| Molecular Formula | C14H20F3N5O |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3R)-1-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(CCCNc2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C14H20F3N5O/c15-14(16,17)11-4-6-20-13(21-11)19-5-2-8-22-7-1-3-10(9-22)12(18)23/h4,6,10H,1-3,5,7-9H2,(H2,18,23)(H,19,20,21)/t10-/m1/s1 |
| InChIKey | FCJKJPBCDDLPRB-SNVBAGLBSA-N |
| XLogP | 1.49 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|