C11H14F3N3O2 — CID 104683281
2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]pentanoic acid (PubChem CID 104683281) has the molecular formula C11H14F3N3O2 and a molecular weight of 277.25 g/mol. Its IUPAC name is 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]pentanoic acid.
| Compound Name | 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 104683281 |
| Molecular Formula | C11H14F3N3O2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]pentanoic acid |
| SMILES | CC(CCCNc1nccc(C(F)(F)F)n1)C(=O)O |
| InChI | InChI=1S/C11H14F3N3O2/c1-7(9(18)19)3-2-5-15-10-16-6-4-8(17-10)11(12,13)14/h4,6-7H,2-3,5H2,1H3,(H,18,19)(H,15,16,17) |
| InChIKey | FILVPLZRYBPAAI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|