C10H12F3N3O2 — CID 81065475
3-methyl-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid (PubChem CID 81065475) has the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. Its IUPAC name is 3-methyl-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid.
| Compound Name | 3-methyl-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 81065475 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-methyl-4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
| SMILES | CC(CNc1nccc(C(F)(F)F)n1)CC(=O)O |
| InChI | InChI=1S/C10H12F3N3O2/c1-6(4-8(17)18)5-15-9-14-3-2-7(16-9)10(11,12)13/h2-3,6H,4-5H2,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | PZPVEGUNYXZPAI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |