C11H14F3N3O2 — CID 64584680
4-methyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]pentanoic acid (PubChem CID 64584680) has the molecular formula C11H14F3N3O2 and a molecular weight of 277.25 g/mol. Its IUPAC name is 4-methyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]pentanoic acid.
| Compound Name | 4-methyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 64584680 |
| Molecular Formula | C11H14F3N3O2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-methyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]pentanoic acid |
| SMILES | CC(C)CC(Nc1nccc(C(F)(F)F)n1)C(=O)O |
| InChI | InChI=1S/C11H14F3N3O2/c1-6(2)5-7(9(18)19)16-10-15-4-3-8(17-10)11(12,13)14/h3-4,6-7H,5H2,1-2H3,(H,18,19)(H,15,16,17) |
| InChIKey | FLNMOZKXMZBBQQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |