C8H10F3N3O — CID 95620017
(2R)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-ol (PubChem CID 95620017) has the molecular formula C8H10F3N3O and a molecular weight of 221.18 g/mol. Its IUPAC name is (2R)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-ol.
| Compound Name | (2R)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 95620017 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | (2R)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-ol |
| SMILES | C[C@H](CO)Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H10F3N3O/c1-5(4-15)13-7-12-3-2-6(14-7)8(9,10)11/h2-3,5,15H,4H2,1H3,(H,12,13,14)/t5-/m1/s1 |
| InChIKey | DRNSETLVLHSLRC-RXMQYKEDSA-N |
| XLogP | 1.29 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |