C11H15ClF3N3 — CID 65029180
N-(1-chloro-4-methylpentan-2-yl)-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 65029180) has the molecular formula C11H15ClF3N3 and a molecular weight of 281.71 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-2-yl)-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(1-chloro-4-methylpentan-2-yl)-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 65029180 |
| Molecular Formula | C11H15ClF3N3 |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-(1-chloro-4-methylpentan-2-yl)-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CC(C)CC(CCl)Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H15ClF3N3/c1-7(2)5-8(6-12)17-10-16-4-3-9(18-10)11(13,14)15/h3-4,7-8H,5-6H2,1-2H3,(H,16,17,18) |
| InChIKey | LLKRIGMYGUGBER-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|