C12H17ClF3N3 — CID 106354403
N-(1-chloro-4,4-dimethylpentan-3-yl)-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 106354403) has the molecular formula C12H17ClF3N3 and a molecular weight of 295.74 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106354403 |
| Molecular Formula | C12H17ClF3N3 |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CC(C)(C)C(CCCl)Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H17ClF3N3/c1-11(2,3)8(4-6-13)18-10-17-7-5-9(19-10)12(14,15)16/h5,7-8H,4,6H2,1-3H3,(H,17,18,19) |
| InChIKey | HGQPXWGSTIQJEK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|