C9H11ClF3N3 — CID 106845038
N-(4-chlorobutyl)-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 106845038) has the molecular formula C9H11ClF3N3 and a molecular weight of 253.65 g/mol. Its IUPAC name is N-(4-chlorobutyl)-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(4-chlorobutyl)-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106845038 |
| Molecular Formula | C9H11ClF3N3 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | N-(4-chlorobutyl)-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1ccnc(NCCCCCl)n1 |
| InChI | InChI=1S/C9H11ClF3N3/c10-4-1-2-5-14-8-15-6-3-7(16-8)9(11,12)13/h3,6H,1-2,4-5H2,(H,14,15,16) |
| InChIKey | VLTIIWZYWAVLLT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|