C10H15F3N4 — CID 107323566
N'-[4-(trifluoromethyl)pyrimidin-2-yl]pentane-1,5-diamine (PubChem CID 107323566) has the molecular formula C10H15F3N4 and a molecular weight of 248.25 g/mol. Its IUPAC name is N'-[4-(trifluoromethyl)pyrimidin-2-yl]pentane-1,5-diamine.
| Compound Name | N'-[4-(trifluoromethyl)pyrimidin-2-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 107323566 |
| Molecular Formula | C10H15F3N4 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N'-[4-(trifluoromethyl)pyrimidin-2-yl]pentane-1,5-diamine |
| SMILES | NCCCCCNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H15F3N4/c11-10(12,13)8-4-7-16-9(17-8)15-6-3-1-2-5-14/h4,7H,1-3,5-6,14H2,(H,15,16,17) |
| InChIKey | PJBCDLISDXELNT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|