C13H21ClF3N5O — CID 119708124
(2S)-2-amino-3,3-dimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]butanamide;hydrochloride (PubChem CID 119708124) has the molecular formula C13H21ClF3N5O and a molecular weight of 355.79 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119708124 |
| Molecular Formula | C13H21ClF3N5O |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]butanamide;hydrochloride |
| SMILES | CC(C)(C)[C@H](N)C(=O)NCCNc1nccc(C(F)(F)F)n1.Cl |
| InChI | InChI=1S/C13H20F3N5O.ClH/c1-12(2,3)9(17)10(22)18-6-7-20-11-19-5-4-8(21-11)13(14,15)16;/h4-5,9H,6-7,17H2,1-3H3,(H,18,22)(H,19,20,21);1H/t9-;/m1./s1 |
| InChIKey | QNLXZKZRFUBHFO-SBSPUUFOSA-N |
| XLogP | 1.82 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|