C15H13F3N4O3 — CID 3515621
2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylcarbamoyl]benzoic acid (PubChem CID 3515621) has the molecular formula C15H13F3N4O3 and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylcarbamoyl]benzoic acid.
| Compound Name | 2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 3515621 |
| Molecular Formula | C15H13F3N4O3 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylcarbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)NCCNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H13F3N4O3/c16-15(17,18)11-5-6-20-14(22-11)21-8-7-19-12(23)9-3-1-2-4-10(9)13(24)25/h1-6H,7-8H2,(H,19,23)(H,24,25)(H,20,21,22) |
| InChIKey | QJVXKHZQFBSDSK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|