C10H15ClF3N5O — CID 119708120
2-(methylamino)-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]acetamide;hydrochloride (PubChem CID 119708120) has the molecular formula C10H15ClF3N5O and a molecular weight of 313.71 g/mol. Its IUPAC name is 2-(methylamino)-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]acetamide;hydrochloride.
| Compound Name | 2-(methylamino)-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119708120 |
| Molecular Formula | C10H15ClF3N5O |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(methylamino)-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]acetamide;hydrochloride |
| SMILES | CNCC(=O)NCCNc1nccc(C(F)(F)F)n1.Cl |
| InChI | InChI=1S/C10H14F3N5O.ClH/c1-14-6-8(19)15-4-5-17-9-16-3-2-7(18-9)10(11,12)13;/h2-3,14H,4-6H2,1H3,(H,15,19)(H,16,17,18);1H |
| InChIKey | SNCPLDVNVASXIT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|