C14H21ClF3N5O2 — CID 119708136
4-methoxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119708136) has the molecular formula C14H21ClF3N5O2 and a molecular weight of 383.80 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-methoxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119708136 |
| Molecular Formula | C14H21ClF3N5O2 |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-methoxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)NCCNc2nccc(C(F)(F)F)n2)CCNCC1.Cl |
| InChI | InChI=1S/C14H20F3N5O2.ClH/c1-24-13(3-6-18-7-4-13)11(23)19-8-9-21-12-20-5-2-10(22-12)14(15,16)17;/h2,5,18H,3-4,6-9H2,1H3,(H,19,23)(H,20,21,22);1H |
| InChIKey | UGMJXUJAUMLSGD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|