C15H24ClN3O4S — CID 119704269
N-[2-(benzenesulfonamido)ethyl]-4-methoxypiperidine-4-carboxamide;hydrochloride (PubChem CID 119704269) has the molecular formula C15H24ClN3O4S and a molecular weight of 377.89 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)ethyl]-4-methoxypiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(benzenesulfonamido)ethyl]-4-methoxypiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119704269 |
| Molecular Formula | C15H24ClN3O4S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[2-(benzenesulfonamido)ethyl]-4-methoxypiperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)NCCNS(=O)(=O)c2ccccc2)CCNCC1.Cl |
| InChI | InChI=1S/C15H23N3O4S.ClH/c1-22-15(7-9-16-10-8-15)14(19)17-11-12-18-23(20,21)13-5-3-2-4-6-13;/h2-6,16,18H,7-12H2,1H3,(H,17,19);1H |
| InChIKey | RBIOFNUFOIUKFX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|