C22H28ClN3O2S — CID 119731855
4-methoxy-N-(3-phenothiazin-10-ylpropyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 119731855) has the molecular formula C22H28ClN3O2S and a molecular weight of 434.01 g/mol. Its IUPAC name is 4-methoxy-N-(3-phenothiazin-10-ylpropyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-methoxy-N-(3-phenothiazin-10-ylpropyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119731855 |
| Molecular Formula | C22H28ClN3O2S |
| Molecular Weight | 434.01 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 4-methoxy-N-(3-phenothiazin-10-ylpropyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)NCCCN2c3ccccc3Sc3ccccc32)CCNCC1.Cl |
| InChI | InChI=1S/C22H27N3O2S.ClH/c1-27-22(11-14-23-15-12-22)21(26)24-13-6-16-25-17-7-2-4-9-19(17)28-20-10-5-3-8-18(20)25;/h2-5,7-10,23H,6,11-16H2,1H3,(H,24,26);1H |
| InChIKey | CLRGXPNUHPJLBZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.01 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|