C22H29ClN4OS — CID 119391157
3-phenothiazin-10-yl-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride (PubChem CID 119391157) has the molecular formula C22H29ClN4OS and a molecular weight of 433.02 g/mol. Its IUPAC name is 3-phenothiazin-10-yl-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride.
| Compound Name | 3-phenothiazin-10-yl-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119391157 |
| Molecular Formula | C22H29ClN4OS |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-phenothiazin-10-yl-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride |
| SMILES | Cl.O=C(CCN1c2ccccc2Sc2ccccc21)NCCCN1CCNCC1 |
| InChI | InChI=1S/C22H28N4OS.ClH/c27-22(24-11-5-14-25-16-12-23-13-17-25)10-15-26-18-6-1-3-8-20(18)28-21-9-4-2-7-19(21)26;/h1-4,6-9,23H,5,10-17H2,(H,24,27);1H |
| InChIKey | CDDYRTFFRKRGHT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|