C19H24ClN3OS — CID 119505196
N-[2-(ethylamino)ethyl]-3-phenothiazin-10-ylpropanamide;hydrochloride (PubChem CID 119505196) has the molecular formula C19H24ClN3OS and a molecular weight of 377.94 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-phenothiazin-10-ylpropanamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-3-phenothiazin-10-ylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119505196 |
| Molecular Formula | C19H24ClN3OS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-phenothiazin-10-ylpropanamide;hydrochloride |
| SMILES | CCNCCNC(=O)CCN1c2ccccc2Sc2ccccc21.Cl |
| InChI | InChI=1S/C19H23N3OS.ClH/c1-2-20-12-13-21-19(23)11-14-22-15-7-3-5-9-17(15)24-18-10-6-4-8-16(18)22;/h3-10,20H,2,11-14H2,1H3,(H,21,23);1H |
| InChIKey | VCURHGIEYMMOMI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|