C18H20N2O2S — CID 78857040
N-(1-hydroxypropan-2-yl)-3-phenothiazin-10-ylpropanamide (PubChem CID 78857040) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-3-phenothiazin-10-ylpropanamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-3-phenothiazin-10-ylpropanamide |
|---|---|
| PubChem CID | 78857040 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-3-phenothiazin-10-ylpropanamide |
| SMILES | CC(CO)NC(=O)CCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C18H20N2O2S/c1-13(12-21)19-18(22)10-11-20-14-6-2-4-8-16(14)23-17-9-5-3-7-15(17)20/h2-9,13,21H,10-12H2,1H3,(H,19,22) |
| InChIKey | YQFDAEQVDQKDPQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|