C27H28N2O3S — CID 2111863
[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 3-phenothiazin-10-ylpropanoate (PubChem CID 2111863) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 3-phenothiazin-10-ylpropanoate.
| Compound Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 3-phenothiazin-10-ylpropanoate |
|---|---|
| PubChem CID | 2111863 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 3-phenothiazin-10-ylpropanoate |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)COC(=O)CCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C27H28N2O3S/c1-20(15-16-21-9-3-2-4-10-21)28-26(30)19-32-27(31)17-18-29-22-11-5-7-13-24(22)33-25-14-8-6-12-23(25)29/h2-14,20H,15-19H2,1H3,(H,28,30)/t20-/m1/s1 |
| InChIKey | QJRITNPBRVXDKI-HXUWFJFHSA-N |
| XLogP | 5.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|